[1,1-Bis(hydroxymethyl)-3-(4-octylphenyl)propyl]carbamic acid Phenylmethyl Ester structure
|
Common Name | [1,1-Bis(hydroxymethyl)-3-(4-octylphenyl)propyl]carbamic acid Phenylmethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 402616-41-5 | Molecular Weight | 441.60300 | |
| Density | 1.091g/cm3 | Boiling Point | 624.7ºC at 760 mmHg | |
| Molecular Formula | C27H39NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.6ºC | |
| Name | [1,1-Bis(hydroxymethyl)-3-(4-octylphenyl)propyl]carbamic acid Phenylmethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 624.7ºC at 760 mmHg |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.60300 |
| Flash Point | 331.6ºC |
| Exact Mass | 441.28800 |
| PSA | 78.79000 |
| LogP | 5.56290 |
| Index of Refraction | 1.551 |
| InChIKey | WHZSMGMWROULJR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1ccc(CCC(CO)(CO)NC(=O)OCc2ccccc2)cc1 |
|
~%
[1,1-Bis(hydrox... CAS#:402616-41-5 |
| Literature: Hale, Jeffrey J.; Yan, Lin; Neway, William E.; Hajdu, Richard; Bergstrom, James D.; Milligan, James A.; Shei, Gan-Ju; Chrebet, Gary L.; Thornton, Rosemary A.; Card, Deborah; Rosenbach, Mark; Hughrosen; Mandala, Suzanne Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 18 p. 4803 - 4807 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| benzyl N-[1-hydroxy-2-(hydroxymethyl)-4-(4-octylphenyl)butan-2-yl]carbamate |