N-(2-amino-4-methylphenyl)-2-methylbenzamide
Modify Date: 2025-10-08 18:37:59
N-(2-amino-4-methylphenyl)-2-methylbenzamide structure
|
Common Name | N-(2-amino-4-methylphenyl)-2-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 402577-84-8 | Molecular Weight | 240.30000 | |
| Density | 1.182g/cm3 | Boiling Point | 334.5ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.1ºC | |
| Name | N-(2-amino-4-methylphenyl)-2-methylbenzamide |
|---|
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 334.5ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 156.1ºC |
| Exact Mass | 240.12600 |
| PSA | 55.12000 |
| LogP | 3.79210 |
| Index of Refraction | 1.656 |
| InChIKey | NRWBZFQBGFCWMB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccccc2C)c(N)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |