N-diphenylphosphoryl-N,N,2-trimethyl-propanimidamide
Modify Date: 2025-09-16 07:06:03
N-diphenylphosphoryl-N,N,2-trimethyl-propanimidamide structure
|
Common Name | N-diphenylphosphoryl-N,N,2-trimethyl-propanimidamide | ||
|---|---|---|---|---|
| CAS Number | 4020-96-6 | Molecular Weight | 314.36200 | |
| Density | 1.06g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C18H23N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | N'-diphenylphosphoryl-N,N,2-trimethylpropanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Molecular Formula | C18H23N2OP |
| Molecular Weight | 314.36200 |
| Flash Point | 210.8ºC |
| Exact Mass | 314.15500 |
| PSA | 42.48000 |
| LogP | 3.53160 |
| Vapour Pressure | 1.98E-07mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | GTKLKZWJQKTVHL-VHEBQXMUSA-N |
| SMILES | CC(C)C(=NP(=O)(c1ccccc1)c1ccccc1)N(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N'-Diphenylphosphinoyl-N,N-dimethyl-isobutyramidin |