2-(Benzylsulfanyl)-4-chlorobenzoyl chloride structure
|
Common Name | 2-(Benzylsulfanyl)-4-chlorobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 40183-55-9 | Molecular Weight | 297.20000 | |
| Density | 1.373g/cm3 | Boiling Point | 398.848ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.017ºC | |
| Name | 2-(Benzylsulfanyl)-4-chlorobenzoyl chloride |
|---|
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 398.848ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2OS |
| Molecular Weight | 297.20000 |
| Flash Point | 195.017ºC |
| Exact Mass | 295.98300 |
| PSA | 42.37000 |
| LogP | 5.01130 |
| Index of Refraction | 1.646 |
| InChIKey | UCLDCZQCSWJORK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(Cl)cc1SCc1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~%
2-(Benzylsulfan... CAS#:40183-55-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 39, # 20 p. 4044 - 4057 |
|
~%
2-(Benzylsulfan... CAS#:40183-55-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 39, # 20 p. 4044 - 4057 |
|
~%
2-(Benzylsulfan... CAS#:40183-55-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 39, # 20 p. 4044 - 4057 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |