Vincaminic acid ethyl ester structure
|
Common Name | Vincaminic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 40163-56-2 | Molecular Weight | 368.46900 | |
| Density | 1.33g/cm3 | Boiling Point | 519.1ºC at 760 mmHg | |
| Molecular Formula | C22H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.8ºC | |
| Name | Ethyl (3α,14β,16α)-14-hydroxy-14,15-dihydroeburnamenine-14-carbox ylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 519.1ºC at 760 mmHg |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.46900 |
| Flash Point | 267.8ºC |
| Exact Mass | 368.21000 |
| PSA | 54.70000 |
| LogP | 3.28050 |
| Index of Refraction | 1.669 |
| InChIKey | XRMLLVHAALNSGZ-HJNYFJLDSA-N |
| SMILES | CCOC(=O)C1(O)CC2(CC)CCCN3CCc4c(n1c1ccccc41)C32 |
| RIDADR | NONH for all modes of transport |
|---|
| Veratric acid,ethyl ester (7CI,8CI) |
| Benzoic acid,3,4-dimethoxy-,ethyl ester |
| ethyl vincaminate |
| 3,4-Dimethoxy-benzoesaeure-aethylester |
| Veratrumsaeure-aethylester |
| (+)-Vincaminic acid ethyl ester |
| 3,4-Dimethoxybenzoic acid ethyl ester |
| ethyl-3,4-dimethoxybenzoate |
| ethyl veratrate |
| (+)-cis-Vincaminic Acid Ethyl Ester |
| Veratric acid,ethyl ester |
| Dimethylaetherprotocatechusaeure-aethylester |
| Vincaminic acid ethyl ester |