2-[hydroxy(2-prop-2-enoyloxyethoxy)phosphoryl]oxyethyl prop-2-enoate structure
|
Common Name | 2-[hydroxy(2-prop-2-enoyloxyethoxy)phosphoryl]oxyethyl prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 40074-34-8 | Molecular Weight | 294.19500 | |
| Density | 1.306g/cm3 | Boiling Point | 415.6ºC at 760 mmHg | |
| Molecular Formula | C10H15O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1ºC | |
| Name | 2-[hydroxy(2-prop-2-enoyloxyethoxy)phosphoryl]oxyethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 415.6ºC at 760 mmHg |
| Molecular Formula | C10H15O8P |
| Molecular Weight | 294.19500 |
| Flash Point | 205.1ºC |
| Exact Mass | 294.05000 |
| PSA | 118.17000 |
| LogP | 0.57840 |
| Index of Refraction | 1.474 |
| InChIKey | WAJJFPMYKWCDNI-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOP(=O)(O)OCCOC(=O)C=C |
| 2-Hydroxyethylacrylate,diester with phosphoric acid |
| EINECS 254-783-0 |
| 2-Propenoic acid,1,1'-(phosphinicobis(oxy-2,1-ethanediyl)) ester |
| Bis(2-(acryloyloxy)ethyl) hydrogen phosphate |
| 2-Propenoic acid,phosphinicobis(oxy-2,1-ethanediyl) ester |
| 4-hydroxy-4-oxido-9-oxo-3,5,8-trioxa-4lambda5-phosphaundec-10-en-1-yl prop-2-enoate |