4-(4-ethoxyphenyl)iminocyclohexa-2,5-dien-1-one structure
|
Common Name | 4-(4-ethoxyphenyl)iminocyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 40014-81-1 | Molecular Weight | 227.25900 | |
| Density | 1.08g/cm3 | Boiling Point | 350.8ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.1ºC | |
| Name | 4-(4-ethoxyphenyl)iminocyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 350.8ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 156.1ºC |
| Exact Mass | 227.09500 |
| PSA | 38.66000 |
| LogP | 2.85290 |
| Index of Refraction | 1.556 |
| InChIKey | XDFSWDQEPRWWCH-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N=C2C=CC(=O)C=C2)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Nebpqi |
| N-p-Ethoxyphenyl-1,4-benzochinonimin |
| 4-(Ethoxyphenyl)-4-benzoquinoneimine |
| 4-(4-Ethoxyphenylimino)-2,5-cyclohexadiene-1-one |
| 4-Eppbqi |
| N-4-(Aethoxyphenyl)-chinonimin |