Cyclopentanemethanol,1-[(dimethylamino)methyl]-, 1-(4-aminobenzoate) structure
|
Common Name | Cyclopentanemethanol,1-[(dimethylamino)methyl]-, 1-(4-aminobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 39943-33-4 | Molecular Weight | 276.37400 | |
| Density | 1.087g/cm3 | Boiling Point | 417.5ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.3ºC | |
| Name | [1-[(dimethylamino)methyl]cyclopentyl]methyl 4-aminobenzoate |
|---|
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760 mmHg |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37400 |
| Flash Point | 206.3ºC |
| Exact Mass | 276.18400 |
| PSA | 55.56000 |
| LogP | 3.12880 |
| Index of Refraction | 1.549 |
| InChIKey | TUJSUONDGOTZRD-UHFFFAOYSA-N |
| SMILES | CN(C)CC1(COC(=O)c2ccc(N)cc2)CCCC1 |
|
~%
Cyclopentanemet... CAS#:39943-33-4 |
| Literature: Newman; Broger; LaPidus; Tye Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1003 - 1006 |