tert-butyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate structure
|
Common Name | tert-butyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 398491-61-7 | Molecular Weight | 252.313 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 420.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1±28.7 °C | |
| Name | tert-Butyl 3-amino-6,6-dimethylpyrrolo[3,4-c]pyrazole-5(1H,4H,6H)-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.6±45.0 °C at 760 mmHg |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.313 |
| Flash Point | 208.1±28.7 °C |
| Exact Mass | 252.158630 |
| PSA | 84.24000 |
| LogP | 0.96 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | XOQXOJPUZGHMLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1Cc2c(N)n[nH]c2C1(C)C |
| HS Code | 2933990090 |
|---|
|
~76%
tert-butyl 3-am... CAS#:398491-61-7 |
| Literature: WO2008/96260 A1, ; Page/Page column 43-44 ; WO 2008/096260 A1 |
|
~46%
tert-butyl 3-am... CAS#:398491-61-7 |
| Literature: WO2013/91773 A1, ; Page/Page column 81 ; |
|
~%
tert-butyl 3-am... CAS#:398491-61-7 |
| Literature: WO2013/91773 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate |
| pyrrolo[3,4-c]pyrazole-5(1H)-carboxylic acid, 3-amino-4,6-dihydro-6,6-dimethyl-, 1,1-dimethylethyl ester |
| tert-butyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1h)-carboxylate |