ethyl 2,2-bis(benzenesulfonyl)acetate structure
|
Common Name | ethyl 2,2-bis(benzenesulfonyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 39837-32-6 | Molecular Weight | 368.42500 | |
| Density | 1.36g/cm3 | Boiling Point | 605.1ºC at 760 mmHg | |
| Molecular Formula | C16H16O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.8ºC | |
| Name | ethyl 2,2-bis(benzenesulfonyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 605.1ºC at 760 mmHg |
| Molecular Formula | C16H16O6S2 |
| Molecular Weight | 368.42500 |
| Flash Point | 319.8ºC |
| Exact Mass | 368.03900 |
| PSA | 111.34000 |
| LogP | 3.98500 |
| Index of Refraction | 1.574 |
| InChIKey | ZOXRJTYSJNCJFM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
|
~%
ethyl 2,2-bis(b... CAS#:39837-32-6 |
| Literature: Breslow,R.; Mohacsi,E. Journal of the American Chemical Society, 1961 , vol. 83, p. 4100 - 4101 |
|
~%
ethyl 2,2-bis(b... CAS#:39837-32-6 |
| Literature: Carpino,L.A. Journal of Organic Chemistry, 1973 , vol. 38, # 15 p. 2600 - 2603 |
| bis-benzenesulfonyl-acetic acid ethyl ester |
| Bis-benzolsulfonyl-essigsaeure-aethylester |