oxido-[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]-[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]iminoazanium structure
|
Common Name | oxido-[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]-[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]iminoazanium | ||
|---|---|---|---|---|
| CAS Number | 39750-11-3 | Molecular Weight | 258.27300 | |
| Density | 1.21g/cm3 | Boiling Point | 417.9ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O3 | Melting Point | 120-122ºC(lit.) | |
| MSDS | USA | Flash Point | 206.6ºC | |
| Name | oxido-[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]-[2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)phenyl]iminoazanium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 417.9ºC at 760 mmHg |
| Melting Point | 120-122ºC(lit.) |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.27300 |
| Flash Point | 206.6ºC |
| Exact Mass | 258.10000 |
| PSA | 59.57000 |
| LogP | 4.15270 |
| Index of Refraction | 1.555 |
| InChIKey | KAEZRSFWWCTVNP-DDAUHAMOSA-N |
| SMILES | COc1ccc(N=[N+]([O-])c2ccc(OC)cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
| 4,4 inverted exclamation marka-Azoxyanisole-d14 |
| Diazene,1,2-bis(4-(methoxy-d3)phenyl-2,3,5,6-d4)-,1-oxide |
| 4,4'-Azoxyanisole-d14 |
| Bis(4-((2H3)methoxy)(2H4)phenyl)diazonium 1-oxide |
| Diazene,bis(4-(methoxy-d3)phenyl-2,3,5,6-d4)-,1-oxide |
| EINECS 254-619-8 |