methyl 2-[(5-oxo-1-phenyl-pyrrolidine-3-carbonyl)amino]benzoate
Modify Date: 2025-10-02 00:12:37
![methyl 2-[(5-oxo-1-phenyl-pyrrolidine-3-carbonyl)amino]benzoate Structure](https://image.chemsrc.com/caspic/476/39630-04-1.png)
methyl 2-[(5-oxo-1-phenyl-pyrrolidine-3-carbonyl)amino]benzoate structure
|
Common Name | methyl 2-[(5-oxo-1-phenyl-pyrrolidine-3-carbonyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 39630-04-1 | Molecular Weight | 338.35700 | |
| Density | 1.316g/cm3 | Boiling Point | 639.3ºC at 760 mmHg | |
| Molecular Formula | C19H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.5ºC | |
| Name | methyl 2-[(5-oxo-1-phenylpyrrolidine-3-carbonyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 639.3ºC at 760 mmHg |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.35700 |
| Flash Point | 340.5ºC |
| Exact Mass | 338.12700 |
| PSA | 79.20000 |
| LogP | 3.17930 |
| Index of Refraction | 1.636 |
| InChIKey | MNPGILARYZHJMK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CC(=O)N(c2ccccc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| METHYL 2-[(5-OXO-1-PHENYL-PYRROLIDINE-3-CARBONYL)AMINO]BENZOATE |
| 2-(5-oxo-1-phenyl-pyrrolidine-3-carbonylamino)-benzoic acid methyl ester |
| benzoic acid,2-[[(5-oxo-1-phenyl-3-pyrrolidinyl)carbonyl]amino]-,methyl ester |
| N-(o-Carboxyphenyl)-2-oxo-1-phenyl-4-pyrrolidinecarboxamide |