Thiophosphoric acid O,O-diethyl O-(6-fluoro-2-pyridinyl) ester
Modify Date: 2024-01-10 22:59:45
Thiophosphoric acid O,O-diethyl O-(6-fluoro-2-pyridinyl) ester structure
|
Common Name | Thiophosphoric acid O,O-diethyl O-(6-fluoro-2-pyridinyl) ester | ||
|---|---|---|---|---|
| CAS Number | 39624-86-7 | Molecular Weight | 265.24200 | |
| Density | 1.293g/cm3 | Boiling Point | 311.5ºC at 760 mmHg | |
| Molecular Formula | C9H13FNO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.2ºC | |
| Name | diethoxy-(6-fluoropyridin-3-yl)oxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 311.5ºC at 760 mmHg |
| Molecular Formula | C9H13FNO3PS |
| Molecular Weight | 265.24200 |
| Flash Point | 142.2ºC |
| Exact Mass | 265.03400 |
| PSA | 82.48000 |
| LogP | 3.54760 |
| Index of Refraction | 1.521 |
| InChIKey | DTWQOKPPRNFERL-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1ccc(F)nc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| O,O-Diethyl O-(6-fluoro-2-pyridyl ester phosphorothioic) acid |
| O,O-Dimethyl S-9-thiabicyclo(4.2.1)nonenyl phosphorodithioate (isomeric mixture) |
| diethoxy-(6-fluoropyridin-3-yl)oxy-sulfanylidene |
| DOWCO 275 |
| Phosphorothioic acid,O,O-diethyl O-(6-fluoro-2-pyridyl) ester |