2-methyl-N-(2-methyl-1-trimethylsilyloxy-propan-2-yl)prop-1-en-1-imine
Modify Date: 2025-08-25 20:46:11
2-methyl-N-(2-methyl-1-trimethylsilyloxy-propan-2-yl)prop-1-en-1-imine structure
|
Common Name | 2-methyl-N-(2-methyl-1-trimethylsilyloxy-propan-2-yl)prop-1-en-1-imine | ||
|---|---|---|---|---|
| CAS Number | 39575-64-9 | Molecular Weight | 213.39200 | |
| Density | 0.82g/cm3 | Boiling Point | 237.3ºC at 760 mmHg | |
| Molecular Formula | C11H23NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.3ºC | |
| Name | 2-methyl-N-(2-methyl-1-trimethylsilyloxypropan-2-yl)prop-1-en-1-imine |
|---|
| Density | 0.82g/cm3 |
|---|---|
| Boiling Point | 237.3ºC at 760 mmHg |
| Molecular Formula | C11H23NOSi |
| Molecular Weight | 213.39200 |
| Flash Point | 97.3ºC |
| Exact Mass | 213.15500 |
| PSA | 21.59000 |
| LogP | 3.25240 |
| Index of Refraction | 1.423 |
| InChIKey | CNRUIWMOFUTLRH-UHFFFAOYSA-N |
| SMILES | CC(C)=C=NC(C)(C)CO[Si](C)(C)C |
|
~%
2-methyl-N-(2-m... CAS#:39575-64-9 |
| Literature: Meyers,A.I. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 2129 - 2136 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |