2-methyl-6-tert-butyl-4-thiocyanato-phenol
Modify Date: 2025-09-22 12:12:49
2-methyl-6-tert-butyl-4-thiocyanato-phenol structure
|
Common Name | 2-methyl-6-tert-butyl-4-thiocyanato-phenol | ||
|---|---|---|---|---|
| CAS Number | 3957-69-5 | Molecular Weight | 221.31900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-tert-butyl-4-hydroxy-5-methylphenyl) thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NOS |
|---|---|
| Molecular Weight | 221.31900 |
| Exact Mass | 221.08700 |
| PSA | 69.32000 |
| LogP | 3.57128 |
| InChIKey | RYWPHPITXKKLJE-UHFFFAOYSA-N |
| SMILES | Cc1cc(SC#N)cc(C(C)(C)C)c1O |
| HS Code | 2930909090 |
|---|
|
~81%
2-methyl-6-tert... CAS#:3957-69-5 |
| Literature: Pastor, Stephen D.; Odorisio, Paul A.; Ravichandran, Ramanathan Phosphorus and Sulfur and the Related Elements, 1987 , vol. 29, p. 67 - 72 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methyl-6-tert-butyl-4-thiocyanato-phenol |
| 3-tert-butyl-4-hydroxy-5-methylphenyl thiocyanate |
| 2-tert-butyl-6-methyl-4-thiocyanatophenol |