3-O-ethyl 5-O-prop-2-enyl 2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Modify Date: 2025-09-06 09:06:51
3-O-ethyl 5-O-prop-2-enyl 2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate structure
|
Common Name | 3-O-ethyl 5-O-prop-2-enyl 2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 39562-63-5 | Molecular Weight | 355.42800 | |
| Density | 1.106g/cm3 | Boiling Point | 480.6ºC at 760 mmHg | |
| Molecular Formula | C21H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
| Name | 3-O-ethyl 5-O-prop-2-enyl 2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 480.6ºC at 760 mmHg |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.42800 |
| Flash Point | 244.4ºC |
| Exact Mass | 355.17800 |
| PSA | 64.63000 |
| LogP | 3.85090 |
| Index of Refraction | 1.533 |
| InChIKey | MCZNMUAPWJIZET-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccccc1C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dimethyl-4-(2'-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid 3-ethyl ester-5-allyl ester |
| 3,5-Pyridinedicarboxylic acid,1,4-dihydro-2,6-dimethyl-4-(2-methylphenyl)-,ethyl 2-propenyl ester |
| ethyl prop-2-en-1-yl 2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Ethyl 2-propenyl 2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydro-3,5-pyridine dicarboxylate |