Methoxyethyl 3-nitrobenzylidenacetoacetate
Modify Date: 2025-08-23 02:42:22
Methoxyethyl 3-nitrobenzylidenacetoacetate structure
|
Common Name | Methoxyethyl 3-nitrobenzylidenacetoacetate | ||
|---|---|---|---|---|
| CAS Number | 39562-22-6 | Molecular Weight | 293.272 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H15NO6 | Melting Point | 72-74ºC | |
| MSDS | N/A | Flash Point | 202.7±29.3 °C | |
| Name | 2-Methoxyethyl (2E)-2-acetyl-3-(3-nitrophenyl)-acrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.2±40.0 °C at 760 mmHg |
| Melting Point | 72-74ºC |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.272 |
| Flash Point | 202.7±29.3 °C |
| Exact Mass | 293.089935 |
| PSA | 98.42000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | UVZJPCAZMGLNTB-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)C(=Cc1cccc([N+](=O)[O-])c1)C(C)=O |
| Storage condition | Refrigerator |
| HS Code | 2918300090 |
|---|
|
~89%
Methoxyethyl 3-... CAS#:39562-22-6 |
| Literature: Lusochimica S.p.A. Patent: US6015906 A1, 2000 ; |
|
~77%
Methoxyethyl 3-... CAS#:39562-22-6 |
| Literature: Meyer; Wehinger; Bossert; Scherling Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 1 p. 106 - 112 |
CAS#:66085-59-4
CAS#:74936-76-8| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-methoxyethyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| EINECS 254-511-0 |
| MFCD00521048 |
| 2-Methoxyethyl (4E)-5-(3-nitrophenyl)-3-oxo-4-pentenoate |
| Butanoic acid, 2-[(3-nitrophenyl)methylene]-3-oxo-, 2-methoxyethyl ester, (2E)- |
| 2-Methoxyethyl (2E)-2-(3-nitrobenzylidene)-3-oxobutanoate |
| 4-Pentenoic acid, 5-(3-nitrophenyl)-3-oxo-, 2-methoxyethyl ester, (4E)- |
| 2-Methoxyethyl 2-(3-nitrobenzylidene)-3-oxobutanoate |