2-(1-ethoxyethylidene)indene-1,3-dione structure
|
Common Name | 2-(1-ethoxyethylidene)indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 39560-91-3 | Molecular Weight | 216.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-ethoxyethylidene)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12O3 |
|---|---|
| Molecular Weight | 216.23300 |
| Exact Mass | 216.07900 |
| PSA | 43.37000 |
| LogP | 2.37610 |
| InChIKey | LGIFDHWNRIKCDY-UHFFFAOYSA-N |
| SMILES | CCOC(C)=C1C(=O)c2ccccc2C1=O |
|
~76%
2-(1-ethoxyethy... CAS#:39560-91-3 |
| Literature: Bohac, Andrej; Perjessy, Alexander; Loos, Dusan; Hrnciar, Pavol Monatshefte fuer Chemie, 1991 , vol. 122, # 11 p. 943 - 948 |
|
~%
2-(1-ethoxyethy... CAS#:39560-91-3 |
| Literature: Knott Journal of the Chemical Society, 1954 , p. 1482,1486 |
| 2-(1-Aethoxy-aethyliden)-indan-1,3-dion |
| 2-(1-ethoxy-ethylidene)-indan-1,3-dione |
| 2(1'-Aethoxyaethyliden)indandion |
| 1H-Indene-1,3(2H)-dione,2-(1-ethoxyethylidene) |
| 2-(ethoxyethylidene)cyclopenta[1,2-a]benzene-1,3-dione |