2-ethanehydrazonoylindene-1,3-dione structure
|
Common Name | 2-ethanehydrazonoylindene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 39560-80-0 | Molecular Weight | 202.20900 | |
| Density | 1.36g/cm3 | Boiling Point | 424ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 2-ethanehydrazonoylindene-1,3-dione |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 210.2ºC |
| Exact Mass | 202.07400 |
| PSA | 72.52000 |
| LogP | 1.71670 |
| Index of Refraction | 1.66 |
| InChIKey | IARSNZAFJCSLSV-AWNIVKPZSA-N |
| SMILES | CC(=NN)C1C(=O)c2ccccc2C1=O |
|
~65%
2-ethanehydrazo... CAS#:39560-80-0 |
| Literature: Hrnciar, Pavel; Svanygova, Eva Collection of Czechoslovak Chemical Communications, 1994 , vol. 59, # 12 p. 2734 - 2740 |
|
~%
2-ethanehydrazo... CAS#:39560-80-0 |
| Literature: Demerac,S. et al. Australian Journal of Chemistry, 1972 , vol. 25, p. 2651 - 2657 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |