2-(3,5-dimethoxyphenyl)propan-2-yl phenyl carbonate structure
|
Common Name | 2-(3,5-dimethoxyphenyl)propan-2-yl phenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 39507-97-6 | Molecular Weight | 316.34800 | |
| Density | 1.146 | Boiling Point | 439.6ºC at 760 mmHg | |
| Molecular Formula | C18H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | 2-(3,5-dimethoxyphenyl)propan-2-yl phenyl carbonate |
|---|
| Density | 1.146 |
|---|---|
| Boiling Point | 439.6ºC at 760 mmHg |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.34800 |
| Flash Point | 192.8ºC |
| Exact Mass | 316.13100 |
| PSA | 53.99000 |
| LogP | 4.15450 |
| Index of Refraction | 1.535 |
| InChIKey | SWALYNJQIGGEAW-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(C(C)(C)OC(=O)Oc2ccccc2)c1 |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |