1-[10-(3-chloropropyl)-10H-phenothiazin-2-yl]ethan-1-one
Modify Date: 2025-09-18 11:39:51
![1-[10-(3-chloropropyl)-10H-phenothiazin-2-yl]ethan-1-one Structure](https://image.chemsrc.com/caspic/486/39481-55-5.png)
1-[10-(3-chloropropyl)-10H-phenothiazin-2-yl]ethan-1-one structure
|
Common Name | 1-[10-(3-chloropropyl)-10H-phenothiazin-2-yl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 39481-55-5 | Molecular Weight | 317.83300 | |
| Density | 1.253g/cm3 | Boiling Point | 507ºC at 760mmHg | |
| Molecular Formula | C17H16ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.4ºC | |
| Name | 1-[10-(3-chloropropyl)phenothiazin-2-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 507ºC at 760mmHg |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.83300 |
| Flash Point | 260.4ºC |
| Exact Mass | 317.06400 |
| PSA | 45.61000 |
| LogP | 5.18580 |
| Index of Refraction | 1.625 |
| InChIKey | LSYMJLKGKFWMLP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)N(CCCCl)c1ccccc1S2 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2934300000 |
|
~%
1-[10-(3-chloro... CAS#:39481-55-5 |
| Literature: Zhuravlev,S.V. et al. J. Gen. Chem. USSR (Engl. Transl.), 1962 , vol. 32, p. 1912 - 1914,1889 - 1891 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:61-00-7![1-[10-(3-piperidin-1-ylpropyl)phenothiazin-2-yl]ethanone structure](https://image.chemsrc.com/caspic/018/98271-51-3.png)
CAS#:98271-51-3| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 254-469-3 |
| 2-Acetyl-10-(3-chloropropyl)phenothiazine |
| 1-[10-(3-CHLOROPROPYL)-10H-PHENOTHIAZIN-2-YL]ETHAN-1-ONE |
| 1-[10-(3-chloro-propyl)-10H-phenothiazin-2-yl]-ethanone |