Methyl 4,6-difluoro-1H-indole-2-carboxylate
Modify Date: 2025-10-01 18:15:02
Methyl 4,6-difluoro-1H-indole-2-carboxylate structure
|
Common Name | Methyl 4,6-difluoro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 394222-99-2 | Molecular Weight | 211.165 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 331.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H7F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.2±26.5 °C | |
| Name | methyl-4,6-difluoroindole-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.3±37.0 °C at 760 mmHg |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.165 |
| Flash Point | 154.2±26.5 °C |
| Exact Mass | 211.044479 |
| PSA | 42.09000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | OQBNNAMXCZSCFC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2c(F)cc(F)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:247564-66-5
CAS#:199526-97-1| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2-carboxylic acid, 4,6-difluoro-, methyl ester |
| Methyl 4,6-difluoro-1H-indole-2-carboxylate |