Thiophosphoric acid O-[2-[acetyl(ethyl)amino]-6-methylpyrimidin-4-yl]O,O-diethyl ester structure
|
Common Name | Thiophosphoric acid O-[2-[acetyl(ethyl)amino]-6-methylpyrimidin-4-yl]O,O-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 39247-96-6 | Molecular Weight | 347.37000 | |
| Density | 1.247g/cm3 | Boiling Point | 438.6ºC at 760 mmHg | |
| Molecular Formula | C13H22N3O4PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1ºC | |
| Name | primidophos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 438.6ºC at 760 mmHg |
| Molecular Formula | C13H22N3O4PS |
| Molecular Weight | 347.37000 |
| Flash Point | 219.1ºC |
| Exact Mass | 347.10700 |
| PSA | 115.68000 |
| LogP | 3.48470 |
| Index of Refraction | 1.552 |
| InChIKey | FBFCWTCMDMUSDI-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1cc(C)nc(N(CC)C(C)=O)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Primidophos |
| O-{2-[acetyl(ethyl)amino]-6-methylpyrimidin-4-yl} O,O-diethyl phosphorothioate |
| O-[2-(acetylethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl phosphorothioate |
| Phosphorothioic acid,O-(2-(acetylethylamino)-6-methyl-4-pyrimidinyl) O,O-diethyl ester |
| O,O-diethyl O-2-N-ethylacetamido-6-methylpyrimidin-4-yl phosphorothioate |
| Prymidophos |
| prymidophos |
| thiophosphoric acid O-[2-(acetyl-ethyl-amino)-6-methyl-pyrimidin-4-yl] ester O',O''-diethyl ester |
| Primidophos [ISO] |
| N-(4-diethoxyphosphinothioyloxy-6-methylpyrimidin-2-yl)-N-ethylacetamide |