4-methoxy-N-(4-methylphenyl)benzamide structure
|
Common Name | 4-methoxy-N-(4-methylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 39192-94-4 | Molecular Weight | 241.28500 | |
| Density | 1.156g/cm3 | Boiling Point | 318.2ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.2ºC | |
| Name | 4-methoxy-N-(4-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 318.2ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 146.2ºC |
| Exact Mass | 241.11000 |
| PSA | 38.33000 |
| LogP | 3.32890 |
| Index of Refraction | 1.61 |
| InChIKey | MMXPRQGDAUNXSX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2ccc(C)cc2)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-methoxy-4'-methylbenzanilide |
| N-(p-methylphenyl)-p-methoxybenzamide |
| 4-methoxy-N-(4-methylphenyl) benzamide |
| 4-methoxy-N-(4-methyl-benzyl)-benzamide |
| N-(4'-methylphenyl)-4-methoxybenzamide |
| 4-Methoxy-N-p-tolyl-benzamide |