4-Benzyloxyphenylacetyl Chloride structure
|
Common Name | 4-Benzyloxyphenylacetyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 39188-62-0 | Molecular Weight | 260.71600 | |
| Density | 1.21g/cm3 | Boiling Point | 387.6ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO2 | Melting Point | 74ºC | |
| MSDS | USA | Flash Point | 142.3ºC | |
| Name | 4-Benzyloxyphenylacetyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 387.6ºC at 760 mmHg |
| Melting Point | 74ºC |
| Molecular Formula | C15H13ClO2 |
| Molecular Weight | 260.71600 |
| Flash Point | 142.3ºC |
| Exact Mass | 260.06000 |
| PSA | 26.30000 |
| LogP | 3.57350 |
| Index of Refraction | 1.581 |
| InChIKey | GZAGJMNAVUCWGM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Cc1ccc(OCc2ccccc2)cc1 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3261 |
| Packaging Group | II |
| HS Code | 2918990090 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-BENZYLOXYPHENYLACETYL CHLORIDE |
| 2-(4-phenylmethoxyphenyl)acetyl chloride |