Pirolazamide structure
|
Common Name | Pirolazamide | ||
|---|---|---|---|---|
| CAS Number | 39186-49-7 | Molecular Weight | 363.49600 | |
| Density | 1.18g/cm3 | Boiling Point | 582.8ºC at 760mmHg | |
| Molecular Formula | C23H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.3ºC | |
| Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2,2-diphenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 582.8ºC at 760mmHg |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.49600 |
| Flash Point | 306.3ºC |
| Exact Mass | 363.23100 |
| PSA | 49.57000 |
| LogP | 3.20420 |
| Index of Refraction | 1.635 |
| InChIKey | SEINJQWGYXAADT-UHFFFAOYSA-N |
| SMILES | NC(=O)C(CCN1CCN2CCCC2C1)(c1ccccc1)c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-GQN5BVM24W |
| Pirolazamide |
| Pirolazamida |
| Pirolazamidum |