pyrene; 2,4,7-trinitrofluoren-9-one structure
|
Common Name | pyrene; 2,4,7-trinitrofluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 3918-78-3 | Molecular Weight | 517.44500 | |
| Density | N/A | Boiling Point | 561.7ºC at 760 mmHg | |
| Molecular Formula | C29H15N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.3ºC | |
| Name | pyrene,2,4,7-trinitrofluoren-9-one |
|---|
| Boiling Point | 561.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C29H15N3O7 |
| Molecular Weight | 517.44500 |
| Flash Point | 292.3ºC |
| Exact Mass | 517.09100 |
| PSA | 154.53000 |
| LogP | 8.77620 |
| InChIKey | SIGROPCIDIOMCL-UHFFFAOYSA-N |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-].c1cc2ccc3cccc4ccc(c1)c2c34 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |