1,2,3,4,6,7,8,9-Octachlorodibenzo[b,d]furan structure
|
Common Name | 1,2,3,4,6,7,8,9-Octachlorodibenzo[b,d]furan | ||
|---|---|---|---|---|
| CAS Number | 39001-02-0 | Molecular Weight | 443.752 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 525.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C12Cl8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9±28.7 °C | |
| Name | 1,2,3,4,6,7,8,9-Octachlorodibenzofuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 525.9±45.0 °C at 760 mmHg |
| Molecular Formula | C12Cl8O |
| Molecular Weight | 443.752 |
| Flash Point | 271.9±28.7 °C |
| Exact Mass | 439.745728 |
| PSA | 13.14000 |
| LogP | 7.22 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | RHIROFAGUQOFLU-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c2c(oc3c(Cl)c(Cl)c(Cl)c(Cl)c32)c1Cl |
CHEMICAL IDENTIFICATION
|
| RIDADR | UN 2811 |
|---|---|
| Hazard Class | 6.1(a) |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,3,4,6,7,8,9-Octachlorodibenzo[b,d]furan |
| 1,2,3,4,6,7,8,9-OCTACHLORODIBENZOFURAN |
| Octachlorodibenzofuran |
| Dibenzofuran, 1,2,3,4,6,7,8,9-octachloro- |