(2-chloro-1-methoxyethyl)benzene structure
|
Common Name | (2-chloro-1-methoxyethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 3898-26-8 | Molecular Weight | 170.63600 | |
| Density | 1.085g/cm3 | Boiling Point | 219.7ºC at 760mmHg | |
| Molecular Formula | C9H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.5ºC | |
| Name | (2-chloro-1-methoxyethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.085g/cm3 |
|---|---|
| Boiling Point | 219.7ºC at 760mmHg |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.63600 |
| Flash Point | 93.5ºC |
| Exact Mass | 170.05000 |
| PSA | 9.23000 |
| LogP | 2.61290 |
| Index of Refraction | 1.51 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Chlor-1-methoxy-1-phenylethan |
| CMBMUYICTPOEOA-UHFFFAOYSA |
| 1-methoxy-1-phenyl-2-chloroethane |
| InChI=1/C9H11ClO/c1-11-9(7-10)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3 |
| 1-phenyl-1-methoxy-2-chloro ethane |
| Benzene,(2-chloro-1-methoxyethyl) |
| 2-Chloro-1-methoxy-1-phenylethane |
| 2-chloro-1-phenyl-1-methoxyethane |