1-(6-Methoxy-2-naphthyl)ethan-1-one oxime structure
|
Common Name | 1-(6-Methoxy-2-naphthyl)ethan-1-one oxime | ||
|---|---|---|---|---|
| CAS Number | 3893-38-7 | Molecular Weight | 215.24800 | |
| Density | 1.12g/cm3 | Boiling Point | 395.9ºC at 760mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.2ºC | |
| Name | 1-(6-Methoxy-2-naphthyl)ethan-1-one oxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 395.9ºC at 760mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 193.2ºC |
| Exact Mass | 215.09500 |
| PSA | 41.82000 |
| LogP | 3.04660 |
| Index of Refraction | 1.564 |
| InChIKey | FKUMAWUBPURONA-NTEUORMPSA-N |
| SMILES | COc1ccc2cc(C(C)=NO)ccc2c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Acetoxy-6-methoxy-naphthalin-oxim |
| 2-ACETOHYDROXIMOYL-6-METHOXYNAPHTHALENE |
| 6-Acetyl-2-methoxy-naphthalin-oxim |