3-(hexyloxyimino-methyl)-rifamycin structure
|
Common Name | 3-(hexyloxyimino-methyl)-rifamycin | ||
|---|---|---|---|---|
| CAS Number | 38850-18-9 | Molecular Weight | 824.95300 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H60N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(hexyloxyimino-methyl)-rifamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C44H60N2O13 |
| Molecular Weight | 824.95300 |
| Exact Mass | 824.41000 |
| PSA | 222.90000 |
| LogP | 6.82290 |
| Index of Refraction | 1.597 |
| InChIKey | LDPVXBOFUGORLE-AWSKAOKOSA-N |
| SMILES | CCCCCCON=Cc1c2c(O)c3c(O)c(C)c4c(c3c1O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
3-(hexyloxyimin... CAS#:38850-18-9 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Formylrifamycin SV O-n-hexyloxim |
| rifaldehyde O-hexyl-oxime |