4-Benzoylphthalic acid structure
|
Common Name | 4-Benzoylphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 3885-88-9 | Molecular Weight | 270.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Benzoylphthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O5 |
|---|---|
| Molecular Weight | 270.23700 |
| Exact Mass | 270.05300 |
| PSA | 91.67000 |
| LogP | 2.31400 |
| InChIKey | ZZVNHEZUTFXFHU-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(C(=O)O)c(C(=O)O)c1 |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-benzoyl-1,2-benzenedicarboxylic acid |
| 4-Benzoyl-phthalic acid |
| 4-Benzoyl-phthalsaeure |