Ethanone,2-bromo-1-(4-fluoro-1-naphthalenyl)-
Modify Date: 2025-08-25 21:55:51
Ethanone,2-bromo-1-(4-fluoro-1-naphthalenyl)- structure
|
Common Name | Ethanone,2-bromo-1-(4-fluoro-1-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 388-31-8 | Molecular Weight | 267.09400 | |
| Density | 1.548g/cm3 | Boiling Point | 362.2ºC at 760mmHg | |
| Molecular Formula | C12H8BrFO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.9ºC | |
| Name | 2-bromo-1-(4-fluoronaphthalen-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 362.2ºC at 760mmHg |
| Molecular Formula | C12H8BrFO |
| Molecular Weight | 267.09400 |
| Flash Point | 172.9ºC |
| Exact Mass | 265.97400 |
| PSA | 17.07000 |
| LogP | 3.55650 |
| Index of Refraction | 1.636 |
| InChIKey | ZNXQKCHZJABDHO-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(F)c2ccccc12 |
| HS Code | 2914700090 |
|---|
|
~99%
Ethanone,2-brom... CAS#:388-31-8 |
| Literature: Bristol-Myers Squibb Company Patent: US2009/75995 A1, 2009 ; Location in patent: Page/Page column 51 ; |
|
~%
Ethanone,2-brom... CAS#:388-31-8 |
| Literature: Buu-Hoi et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 542 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:650626-11-2
CAS#:388-62-5| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1-(4-fluoro-naphthalen-1-yl)-ethanone |
| 2-bromo-1-(4-fluoro-[1]naphthyl)-ethanone |
| PC6383 |
| 2-Brom-1-(4-fluor-[1]naphthyl)-aethanon |
| 2-Bromo-4'-fluoro-1'-acetonaphthone |