4-[4-[4-(3,4-dicyanophenoxy)phenyl]phenoxy]benzene-1,2-dicarbonitrile structure
|
Common Name | 4-[4-[4-(3,4-dicyanophenoxy)phenyl]phenoxy]benzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 38791-69-4 | Molecular Weight | 438.43600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-[4-(3,4-dicyanophenoxy)phenyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H14N4O2 |
|---|---|
| Molecular Weight | 438.43600 |
| Exact Mass | 438.11200 |
| PSA | 113.62000 |
| LogP | 6.42492 |
| InChIKey | GCQXFKBSPSLVPY-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Oc2ccc(-c3ccc(Oc4ccc(C#N)c(C#N)c4)cc3)cc2)cc1C#N |
|
~92%
4-[4-[4-(3,4-di... CAS#:38791-69-4 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4304896 A1, 1981 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-Bis-(3,4-dicyanophenoxy)biphenyl |
| 4,4'-[(1,1'-biphenyl)-4,4'-diylbis(oxy)]bis-1,2-benzenedicarbonitrile |
| 1,2-Benzenedicarbonitrile,4,4'-[[1,1'-biphenyl]-4,4'-diylbis(oxy)]bis |
| p,p'-Bis(3,4-Dicyanophenoxy)Biphenyl |