ethyl 2-(benzylamino)cyclohexene-1-carboxylate
Modify Date: 2025-08-25 15:01:23
ethyl 2-(benzylamino)cyclohexene-1-carboxylate structure
|
Common Name | ethyl 2-(benzylamino)cyclohexene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38778-78-8 | Molecular Weight | 259.34300 | |
| Density | 1.08g/cm3 | Boiling Point | 398.7ºC at 760 mmHg | |
| Molecular Formula | C16H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.9ºC | |
| Name | ethyl 2-(benzylamino)cyclohexene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 398.7ºC at 760 mmHg |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.34300 |
| Flash Point | 194.9ºC |
| Exact Mass | 259.15700 |
| PSA | 38.33000 |
| LogP | 3.55830 |
| Index of Refraction | 1.547 |
| InChIKey | SZJAFTIFKQOVPU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NCc2ccccc2)CCCC1 |
| HS Code | 2922499990 |
|---|
|
~90%
ethyl 2-(benzyl... CAS#:38778-78-8 |
| Literature: Laskar, Rajibul A.; Begum, Naznin A.; Hedayetullah Mir, Mohammad; Ali, Shahzad; Khan, Abu T. Tetrahedron Letters, 2013 , vol. 54, # 5 p. 436 - 440 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![[(1R,2S)-2-(Benzylamino)cyclohexyl]methanol structure](https://image.chemsrc.com/caspic/398/71581-92-5.png)
CAS#:71581-92-5| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1-Benzylamino-2-ethoxycarbonyl-cyclohexen |
| ETHYL 2-[(BENZYL)AMINO]CYCLOHEXENE-1-CARBOXYLATE |
| ethyl 3-(benzylamino)cyclohexene-2-enoate |
| 2-benzylamino-cyclohex-1-enecarboxylic acid ethyl ester |
| (Z)-ethyl-3-(benzylamino)cyclohex-2-enoate |
| EINECS 254-124-7 |
| 2-Benzylamino-1-cyclohexencarbonsaeure-ethylester |