2-[fluoro(methyl)phosphoryl]oxypropyl-trimethylazanium,iodide
Modify Date: 2025-09-30 20:25:39
![2-[fluoro(methyl)phosphoryl]oxypropyl-trimethylazanium,iodide Structure](https://image.chemsrc.com/caspic/030/3873-20-9.png)
2-[fluoro(methyl)phosphoryl]oxypropyl-trimethylazanium,iodide structure
|
Common Name | 2-[fluoro(methyl)phosphoryl]oxypropyl-trimethylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 3873-20-9 | Molecular Weight | 325.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H18FINO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[fluoro(methyl)phosphoryl]oxypropyl-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H18FINO2P |
|---|---|
| Molecular Weight | 325.10000 |
| Exact Mass | 325.01000 |
| PSA | 36.11000 |
| InChIKey | LYPOKWZHLFSWJC-UHFFFAOYSA-M |
| SMILES | CC(C[N+](C)(C)C)OP(C)(=O)F.[I-] |
| HS Code | 2931900090 |
|---|
|
~%
2-[fluoro(methy... CAS#:3873-20-9 |
| Literature: Tammelin Acta Chemica Scandinavica (1947-1973), 1957 , vol. 11, p. 859,860,861 |
|
~%
2-[fluoro(methy... CAS#:3873-20-9 |
| Literature: Tammelin Acta Chemica Scandinavica (1947-1973), 1957 , vol. 11, p. 859,860,861 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-[fluoro(methyl)phosphoryl]oxypropyl-trimethylazanium iodide |
| [2-(Fluor-methyl-phosphinoyloxy)-propyl]-trimethyl-ammonium,Jodid |
| Ammonium,(2-hydroxypropyl)trimethyl-,iodide,methylphosphonofluoridate,(ester) |
| [2-(fluoro-methyl-phosphinoyloxy)-propyl]-trimethyl-ammonium,iodide |
| 2-Trimethylammonium-1-methylethyl methylphosphonofluoridate iodide |