2,3-Diphenyl-5,8-quinoxalinedione
Modify Date: 2025-11-26 16:38:38
2,3-Diphenyl-5,8-quinoxalinedione structure
|
Common Name | 2,3-Diphenyl-5,8-quinoxalinedione | ||
|---|---|---|---|---|
| CAS Number | 38674-89-4 | Molecular Weight | 312.32100 | |
| Density | 1.303g/cm3 | Boiling Point | 512.7ºC at 760 mmHg | |
| Molecular Formula | C20H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.1ºC | |
| Name | 2,3-diphenylquinoxaline-5,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 512.7ºC at 760 mmHg |
| Molecular Formula | C20H12N2O2 |
| Molecular Weight | 312.32100 |
| Flash Point | 259.1ºC |
| Exact Mass | 312.09000 |
| PSA | 59.92000 |
| LogP | 3.74580 |
| Index of Refraction | 1.658 |
| InChIKey | VNBZDYJWROOJRD-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)c2nc(-c3ccccc3)c(-c3ccccc3)nc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-diphenyl-quinoxaline-5,8-dione |
| 2,3-Diphenyl-chinoxalin-5,8-chinon |
| 2,3-Diphenyl-chinoxalin-5,8-dion |
| 2,3-Diphenyl-5,8-chinoxalin-dion |
| 2,3-Diphenyl-5,8-quinoxalinedione |
| 2.3-Diphenyl-5.8-dioxo-5H.8H-chinoxalin |