1-cyclohexyl-3-[4-[3-(cyclohexylamino)-2-hydroxy-propoxy]phenyl]urea structure
|
Common Name | 1-cyclohexyl-3-[4-[3-(cyclohexylamino)-2-hydroxy-propoxy]phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 38651-95-5 | Molecular Weight | 389.53200 | |
| Density | 1.15g/cm3 | Boiling Point | 571ºC at 760mmHg | |
| Molecular Formula | C22H35N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.1ºC | |
| Name | 1-cyclohexyl-3-[4-[3-(cyclohexylamino)-2-hydroxypropoxy]phenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 571ºC at 760mmHg |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.53200 |
| Flash Point | 299.1ºC |
| Exact Mass | 389.26800 |
| PSA | 86.11000 |
| LogP | 4.47110 |
| Index of Refraction | 1.569 |
| InChIKey | KSQZLKFCBZMSKA-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(OCC(O)CNC2CCCCC2)cc1)NC1CCCCC1 |
| HS Code | 2924299090 |
|---|
|
~%
1-cyclohexyl-3-... CAS#:38651-95-5 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
|
~%
1-cyclohexyl-3-... CAS#:38651-95-5 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
|
~%
1-cyclohexyl-3-... CAS#:38651-95-5 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Urea,N-cyclohexyl-N'-(4-(3-(cyclohexylamino)-2-hydroxypropoxy)phenyl) |
| N-Cyclohexyl-N'-(4-(3-(cyclohexylamino)-2-hydroxypropoxy)phenyl)urea |
| 1-cyclohexyl-3-{4-[3-(cyclohexylamino)-2-hydroxypropoxy]phenyl}urea |