3-[4-[[4-(2-carboxyethenyl)phenyl]disulfanyl]phenyl]prop-2-enoic acid
Modify Date: 2025-08-31 10:41:15
![3-[4-[[4-(2-carboxyethenyl)phenyl]disulfanyl]phenyl]prop-2-enoic acid Structure](https://image.chemsrc.com/caspic/469/38650-27-0.png)
3-[4-[[4-(2-carboxyethenyl)phenyl]disulfanyl]phenyl]prop-2-enoic acid structure
|
Common Name | 3-[4-[[4-(2-carboxyethenyl)phenyl]disulfanyl]phenyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 38650-27-0 | Molecular Weight | 358.43100 | |
| Density | 1.42g/cm3 | Boiling Point | 586.7ºC at 760 mmHg | |
| Molecular Formula | C18H14O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.6ºC | |
| Name | 3-[4-[[4-(2-carboxyethenyl)phenyl]disulfanyl]phenyl]prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 586.7ºC at 760 mmHg |
| Molecular Formula | C18H14O4S2 |
| Molecular Weight | 358.43100 |
| Flash Point | 308.6ºC |
| Exact Mass | 358.03300 |
| PSA | 125.20000 |
| LogP | 4.68160 |
| Index of Refraction | 1.713 |
| InChIKey | AUSTUSJOMJITTD-YDWXAUTNSA-N |
| SMILES | O=C(O)C=Cc1ccc(SSc2ccc(C=CC(=O)O)cc2)cc1 |
|
~%
3-[4-[[4-(2-car... CAS#:38650-27-0 |
| Literature: Campaigne; Meyer Journal of Organic Chemistry, 1962 , vol. 27, p. 2835,2841 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,4'-disulfanediyl-di-trans-cinnamic acid |
| 4.4'-Dithio-bis-trans-zimtsaeure |
| 4,4`-Dithiobiscinnamic Acid |
| 4,4'-Disulfandiyl-di-trans-zimtsaeure |