m-(p-tolylsulphonyloxy)aniline
Modify Date: 2025-09-14 10:26:31
m-(p-tolylsulphonyloxy)aniline structure
|
Common Name | m-(p-tolylsulphonyloxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 3865-15-4 | Molecular Weight | 263.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | m-(p-tolylsulphonyloxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO3S |
|---|---|
| Molecular Weight | 263.31200 |
| Exact Mass | 263.06200 |
| PSA | 77.77000 |
| LogP | 4.00690 |
| InChIKey | RUZVAAMFWWVKGG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(N)c2)cc1 |
| HS Code | 2922199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:210907-84-9| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Toluol-4-sulfonsaeure-(3-amino-phenylester) |
| toluene-4-sulfonic acid-(3-amino-phenyl ester) |
| m-Aminophenyl Tosylate |
| O-tosyl-m-aminophenol |
| m-aminophenyl tosylate |
| 3-aminophenyl tosylate |
| p-Toluolsulfonsaeure-(3-amino-phenylester) |