(4-chlorophenyl)guanidine mononitrate
Modify Date: 2025-09-13 11:26:12
(4-chlorophenyl)guanidine mononitrate structure
|
Common Name | (4-chlorophenyl)guanidine mononitrate | ||
|---|---|---|---|---|
| CAS Number | 38647-83-5 | Molecular Weight | 232.62400 | |
| Density | N/A | Boiling Point | 371.4ºC at 760 mmHg | |
| Molecular Formula | C7H9ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.4ºC | |
| Name | 2-(4-chlorophenyl)guanidine,nitric acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 371.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H9ClN4O3 |
| Molecular Weight | 232.62400 |
| Flash Point | 178.4ºC |
| Exact Mass | 232.03600 |
| PSA | 127.95000 |
| LogP | 2.69390 |
| InChIKey | XDIUTUZPPZXWMN-UHFFFAOYSA-N |
| SMILES | NC(N)=Nc1ccc(Cl)cc1.O=[N+]([O-])O |
| HS Code | 2925290090 |
|---|
|
~59%
(4-chlorophenyl... CAS#:38647-83-5 |
| Literature: Cayir, Merve; Ghoochany, Leila Taghizadeh; Walli, Adam; Busch, Mark; Sun, Yu; Meyer, Franc; Braese, Stefan; Thiel, Werner R. European Journal of Inorganic Chemistry, 2014 , # 16 p. 2618 - 2624 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(4-chlorophenyl)guanidine nitrate |
| EINECS 254-059-4 |
| 4-chlorophenylguanidine nitrate |
| (4-Chlorophenyl)guanidine mononitrate |
| (4-Chlor-phenyl)-guanidin,Nitrat |
| N-(4-chloro-phenyl)-guanidine nitrate |