4-oxo-4-phenyl-8,10-diaza-4$l^C13H14N3OP-phosphabicyclo[4.4.0]deca-7,9,11-trien-7-amine structure
|
Common Name | 4-oxo-4-phenyl-8,10-diaza-4$l^C13H14N3OP-phosphabicyclo[4.4.0]deca-7,9,11-trien-7-amine | ||
|---|---|---|---|---|
| CAS Number | 38626-78-7 | Molecular Weight | 259.24400 | |
| Density | 1.32g/cm3 | Boiling Point | 567.5ºC at 760mmHg | |
| Molecular Formula | C13H14N3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297ºC | |
| Name | 6-oxo-6-phenyl-7,8-dihydro-5H-phosphinino[4,3-d]pyrimidin-4-amine |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 567.5ºC at 760mmHg |
| Molecular Formula | C13H14N3OP |
| Molecular Weight | 259.24400 |
| Flash Point | 297ºC |
| Exact Mass | 259.08700 |
| PSA | 78.68000 |
| LogP | 2.38470 |
| InChIKey | RNKVFJOODRZZHI-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2c1CP(=O)(c1ccccc1)CC2 |
|
~%
4-oxo-4-phenyl-... CAS#:38626-78-7 |
| Literature: Snider; Berlin The Journal of organic chemistry, 1973 , vol. 38, # 9 p. 1657 - 1662 |
|
~%
4-oxo-4-phenyl-... CAS#:38626-78-7 |
| Literature: Snider; Berlin The Journal of organic chemistry, 1973 , vol. 38, # 9 p. 1657 - 1662 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |