4-chloro-N-((1E)-(3,4-dimethoxyphenyl)methylidene)aniline (en)Benzenamine, 4-chloro-N-[(3,4-dimethoxyphenyl)methylene]- (en) structure
|
Common Name | 4-chloro-N-((1E)-(3,4-dimethoxyphenyl)methylidene)aniline (en)Benzenamine, 4-chloro-N-[(3,4-dimethoxyphenyl)methylene]- (en) | ||
|---|---|---|---|---|
| CAS Number | 38608-18-3 | Molecular Weight | 275.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-((1E)-(3,4-dimethoxyphenyl)methylidene)aniline (en)Benzenamine, 4-chloro-N-[(3,4-dimethoxyphenyl)methylene]- (en) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14ClNO2 |
|---|---|
| Molecular Weight | 275.73000 |
| Exact Mass | 275.07100 |
| PSA | 30.82000 |
| LogP | 4.10780 |
| InChIKey | WHGPHFJFPUJFKV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(Cl)cc2)cc1OC |
|
~99%
4-chloro-N-((1E... CAS#:38608-18-3 |
| Literature: Rai, Mangat; Kaur, Baljit; Dhir, B. S. Journal of the Indian Chemical Society, 1982 , vol. 59, # 3 p. 416 - 417 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-chloro-N-pyridin-2-yl-benzamide |
| 3,4-dimethoxybezal-p-chloroaniline |