(2-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate structure
|
Common Name | (2-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 38605-58-2 | Molecular Weight | 353.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-nitrophenyl) (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19N3O7 |
|---|---|
| Molecular Weight | 353.32700 |
| Exact Mass | 353.12200 |
| PSA | 153.54000 |
| LogP | 2.88330 |
| InChIKey | KSOSHRILCLONAA-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(N)=O)C(=O)Oc1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
(2-nitrophenyl)... CAS#:38605-58-2 |
| Literature: Bodanszky,M. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 3565 - 3570 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-Asn-ONO |
| Nalpha-Boc-L-asparagine 2-nitrophenyl ester |