ethyl 5-[(2,3-dimethylphenyl)carbamoyl]-2-hydroxy-benzoate
Modify Date: 2025-10-28 16:33:50
![ethyl 5-[(2,3-dimethylphenyl)carbamoyl]-2-hydroxy-benzoate Structure](https://image.chemsrc.com/caspic/014/38539-79-6.png)
ethyl 5-[(2,3-dimethylphenyl)carbamoyl]-2-hydroxy-benzoate structure
|
Common Name | ethyl 5-[(2,3-dimethylphenyl)carbamoyl]-2-hydroxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 38539-79-6 | Molecular Weight | 313.34800 | |
| Density | 1.235g/cm3 | Boiling Point | 410.8ºC at 760mmHg | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | ethyl 5-[(2,3-dimethylphenyl)carbamoyl]-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 410.8ºC at 760mmHg |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.34800 |
| Flash Point | 202.3ºC |
| Exact Mass | 313.13100 |
| PSA | 79.12000 |
| LogP | 3.82200 |
| Index of Refraction | 1.617 |
| InChIKey | MUTHJQAWFWDDDK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2cccc(C)c2C)ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl 5-(((2,3-dimethylphenyl)amino)carbonyl)-2-hydroxybenzoate |
| Benzoic acid,5-(((2,3-dimethylphenyl)amino)carbonyl)-2-hydroxy-,ethyl ester |
| ETHYL 5-[(2,3-DIMETHYLPHENYL)CARBAMOYL]-2-HYDROXY-BENZOATE |