dioctyl 2,3,5,6-tetrachlorobenzene-1,4-dicarboxylate structure
|
Common Name | dioctyl 2,3,5,6-tetrachlorobenzene-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 38532-99-9 | Molecular Weight | 528.33600 | |
| Density | 1.189g/cm3 | Boiling Point | 576.8ºC at 760 mmHg | |
| Molecular Formula | C24H34Cl4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.3ºC | |
| Name | dioctyl 2,3,5,6-tetrachlorobenzene-1,4-dicarboxylate |
|---|
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 576.8ºC at 760 mmHg |
| Molecular Formula | C24H34Cl4O4 |
| Molecular Weight | 528.33600 |
| Flash Point | 168.3ºC |
| Exact Mass | 526.12100 |
| PSA | 52.60000 |
| LogP | 9.33480 |
| Index of Refraction | 1.516 |
| InChIKey | WGCOZZYDJXJXQV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1c(Cl)c(Cl)c(C(=O)OCCCCCCCC)c(Cl)c1Cl |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |