5-(4-nitrophenyl)diazenylpyrimidine-2,4,6-triamine
Modify Date: 2025-11-30 16:38:18
5-(4-nitrophenyl)diazenylpyrimidine-2,4,6-triamine structure
|
Common Name | 5-(4-nitrophenyl)diazenylpyrimidine-2,4,6-triamine | ||
|---|---|---|---|---|
| CAS Number | 38522-19-9 | Molecular Weight | 274.23900 | |
| Density | 1.81g/cm3 | Boiling Point | 692.7ºC at 760mmHg | |
| Molecular Formula | C10H10N8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.7ºC | |
| Name | 5-[(4-nitrophenyl)diazenyl]pyrimidine-2,4,6-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 692.7ºC at 760mmHg |
| Molecular Formula | C10H10N8O2 |
| Molecular Weight | 274.23900 |
| Flash Point | 372.7ºC |
| Exact Mass | 274.09300 |
| PSA | 175.84000 |
| LogP | 2.51140 |
| Index of Refraction | 1.843 |
| InChIKey | YPEQJEXUPPTOKW-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(N=Nc2ccc([N+](=O)[O-])cc2)c(N)n1 |
| HS Code | 2933599090 |
|---|
|
~%
5-(4-nitropheny... CAS#:38522-19-9 |
| Literature: Belodedova, Zh. V.; Smorygo, N. A.; Mirzoyan, V. S.; Melik-Orandzhanyan, R. G.; Studentsov, E. P.; Ivin, B. A. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1988 , p. 538 - 545 Khimiya Geterotsiklicheskikh Soedinenii, 1988 , vol. 24, # 5 p. 659 - 667 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-Nitro-phenylazo)-pyrimidin-2,4,6-triyltriamin |
| Pyrimidine,5-(p-nitrophenylazo)-2,4,6-triamino |
| 5-(4-nitro-phenylazo)-pyrimidine-2,4,6-triyltriamine |
| 5-(4-nitro-phenylazo)-pyrimidine-2,4,6-triamine |
| 5-[(e)-(4-nitrophenyl)diazenyl]pyrimidine-2,4,6-triamine |
| PY-84 |
| 5-(p-Nitrophenylazo)-2,4,6-triaminopyrimidine |