ethyl 2-hydroxy-5-[(2-methylphenyl)carbamoyl]benzoate structure
|
Common Name | ethyl 2-hydroxy-5-[(2-methylphenyl)carbamoyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 38507-88-9 | Molecular Weight | 299.32100 | |
| Density | 1.26g/cm3 | Boiling Point | 394.9ºC at 760 mmHg | |
| Molecular Formula | C17H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6ºC | |
| Name | ethyl 2-hydroxy-5-[(2-methylphenyl)carbamoyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 394.9ºC at 760 mmHg |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.32100 |
| Flash Point | 192.6ºC |
| Exact Mass | 299.11600 |
| PSA | 79.12000 |
| LogP | 3.51360 |
| Index of Refraction | 1.625 |
| InChIKey | WWSTZECIMAHKMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccccc2C)ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,2-hydroxy-5-(((2-methylphenyl)amino)carbonyl)-,ethyl ester |
| Ethyl 2-hydroxy-5-(((2-methylphenyl)amino)carbonyl)benzoate |