1,6-dimethyl-3-phenylpyrimidine-2,4-dione structure
|
Common Name | 1,6-dimethyl-3-phenylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 38507-46-9 | Molecular Weight | 216.23600 | |
| Density | 1.221g/cm3 | Boiling Point | 327.2ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.3ºC | |
| Name | 1,6-dimethyl-3-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 327.2ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 140.3ºC |
| Exact Mass | 216.09000 |
| PSA | 44.00000 |
| LogP | 0.84460 |
| Index of Refraction | 1.584 |
| InChIKey | WLHNIAFXLFNQHK-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(-c2ccccc2)c(=O)n1C |
|
~%
1,6-dimethyl-3-... CAS#:38507-46-9 |
| Literature: Senda; Suzui Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 476,478 |
|
~%
1,6-dimethyl-3-... CAS#:38507-46-9 |
| Literature: Lacey Journal of the Chemical Society, 1954 , p. 854,859 |
|
~%
1,6-dimethyl-3-... CAS#:38507-46-9 |
| Literature: Lacey Journal of the Chemical Society, 1954 , p. 854,859 |
|
~%
1,6-dimethyl-3-... CAS#:38507-46-9 |
| Literature: Lacey Journal of the Chemical Society |
| 1,6-dimethyl-3-phenyl-1H-pyrimidine-2,4-dione |
| 3-Phenyl-1,6-dimethyl-uracil |
| 2,4(1H,3H)-Pyrimidinedione,1,6-dimethyl-3-phenyl |
| 1,6-Dimethyl-3-phenyl-2,4(1H,3H)-pyrimidinedione |
| Ro 42-6961 |
| 1,6-dimethyl-3-phenylpyrimidine-2,4(1H,3H)-dione |
| 1,6-Dimethyl-3-phenyl-1H-pyrimidin-2,4-dion |