1-(4-chlorophenyl)-6-methylpyrimidine-2,4-dione structure
|
Common Name | 1-(4-chlorophenyl)-6-methylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 38507-36-7 | Molecular Weight | 236.65400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-6-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9ClN2O2 |
|---|---|
| Molecular Weight | 236.65400 |
| Exact Mass | 236.03500 |
| PSA | 55.12000 |
| LogP | 1.89990 |
| InChIKey | SEKCBDGZPRMHAO-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)[nH]c(=O)n1-c1ccc(Cl)cc1 |
|
~38%
1-(4-chlorophen... CAS#:38507-36-7 |
| Literature: Singh, Harjit; Singh, Palwinder; Aggarwal, Pawan; Kumar, Subodh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 6 p. 731 - 736 |
|
~%
1-(4-chlorophen... CAS#:38507-36-7 |
| Literature: Singh, Harjit; Singh, Palwinder; Aggarwal, Pawan; Kumar, Subodh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 6 p. 731 - 736 |
|
~%
1-(4-chlorophen... CAS#:38507-36-7 |
| Literature: Fraser; Kermack Journal of the Chemical Society, 1951 , p. 2682,2686 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4-Chlor-phenyl)-6-methyl-1H-pyrimidin-2,4-dion |
| 1-(4-chloro-phenyl)-6-methyl-1H-pyrimidine-2,4-dione |
| 1-(4-Chlor-phenyl)-6-methyl-uracil |
| 2,4(1H,3H)-Pyrimidinedione,1-(4-chlorophenyl)-6-methyl |